C16H21N3O4 — CID 17052939
3-imidazol-1-yl-N-[(2-methylphenyl)methyl]propan-1-amine;oxalic acid (PubChem CID 17052939) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 3-imidazol-1-yl-N-[(2-methylphenyl)methyl]propan-1-amine;oxalic acid.
| Compound Name | 3-imidazol-1-yl-N-[(2-methylphenyl)methyl]propan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 17052939 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 3-imidazol-1-yl-N-[(2-methylphenyl)methyl]propan-1-amine;oxalic acid |
| SMILES | Cc1ccccc1CNCCCn1ccnc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H19N3.C2H2O4/c1-13-5-2-3-6-14(13)11-15-7-4-9-17-10-8-16-12-17;3-1(4)2(5)6/h2-3,5-6,8,10,12,15H,4,7,9,11H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | HIAFLBNWTDVZRT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|