C15H19N3 — CID 168665221
N-[(2-ethenylphenyl)methyl]-3-imidazol-1-ylpropan-1-amine (PubChem CID 168665221) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is N-[(2-ethenylphenyl)methyl]-3-imidazol-1-ylpropan-1-amine.
| Compound Name | N-[(2-ethenylphenyl)methyl]-3-imidazol-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 168665221 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | N-[(2-ethenylphenyl)methyl]-3-imidazol-1-ylpropan-1-amine |
| SMILES | C=Cc1ccccc1CNCCCn1ccnc1 |
| InChI | InChI=1S/C15H19N3/c1-2-14-6-3-4-7-15(14)12-16-8-5-10-18-11-9-17-13-18/h2-4,6-7,9,11,13,16H,1,5,8,10,12H2 |
| InChIKey | SYVZVWUENVCTAZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|