C14H17N5 — CID 59506750
3-imidazol-1-yl-N-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)propan-1-amine (PubChem CID 59506750) has the molecular formula C14H17N5 and a molecular weight of 255.33 g/mol. Its IUPAC name is 3-imidazol-1-yl-N-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)propan-1-amine.
| Compound Name | 3-imidazol-1-yl-N-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 59506750 |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 3-imidazol-1-yl-N-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)propan-1-amine |
| SMILES | c1cnc2[nH]cc(CNCCCn3ccnc3)c2c1 |
| InChI | InChI=1S/C14H17N5/c1-3-13-12(10-18-14(13)17-5-1)9-15-4-2-7-19-8-6-16-11-19/h1,3,5-6,8,10-11,15H,2,4,7,9H2,(H,17,18) |
| InChIKey | NIDILLWQSQTRJS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|