C14H15N5O — CID 110474998
N-(3-imidazol-1-ylpropyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxamide (PubChem CID 110474998) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110474998 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)c1c[nH]c2ncccc12 |
| InChI | InChI=1S/C14H15N5O/c20-14(17-5-2-7-19-8-6-15-10-19)12-9-18-13-11(12)3-1-4-16-13/h1,3-4,6,8-10H,2,5,7H2,(H,16,18)(H,17,20) |
| InChIKey | JUUSPPMHMABHSG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|