C11H16N4O2S — CID 114174786
N-methyl-2-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)ethanesulfonamide (PubChem CID 114174786) has the molecular formula C11H16N4O2S and a molecular weight of 268.34 g/mol. Its IUPAC name is N-methyl-2-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)ethanesulfonamide.
| Compound Name | N-methyl-2-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)ethanesulfonamide |
|---|---|
| PubChem CID | 114174786 |
| Molecular Formula | C11H16N4O2S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | N-methyl-2-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)ethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNCc1c[nH]c2ncccc12 |
| InChI | InChI=1S/C11H16N4O2S/c1-12-18(16,17)6-5-13-7-9-8-15-11-10(9)3-2-4-14-11/h2-4,8,12-13H,5-7H2,1H3,(H,14,15) |
| InChIKey | BDSQBOCYFQISSK-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|