C16H24N4O2 — CID 107241138
tert-butyl N-[3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)propyl]carbamate (PubChem CID 107241138) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is tert-butyl N-[3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)propyl]carbamate |
|---|---|
| PubChem CID | 107241138 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | tert-butyl N-[3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNCc1c[nH]c2ncccc12 |
| InChI | InChI=1S/C16H24N4O2/c1-16(2,3)22-15(21)19-9-5-7-17-10-12-11-20-14-13(12)6-4-8-18-14/h4,6,8,11,17H,5,7,9-10H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | PBLYAASCINWKIY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|