C17H22ClN3O2 — CID 103821885
tert-butyl N-[3-[(5-chloroquinolin-8-yl)amino]propyl]carbamate (PubChem CID 103821885) has the molecular formula C17H22ClN3O2 and a molecular weight of 335.84 g/mol. Its IUPAC name is tert-butyl N-[3-[(5-chloroquinolin-8-yl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(5-chloroquinolin-8-yl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 103821885 |
| Molecular Formula | C17H22ClN3O2 |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | tert-butyl N-[3-[(5-chloroquinolin-8-yl)amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNc1ccc(Cl)c2cccnc12 |
| InChI | InChI=1S/C17H22ClN3O2/c1-17(2,3)23-16(22)21-11-5-10-19-14-8-7-13(18)12-6-4-9-20-15(12)14/h4,6-9,19H,5,10-11H2,1-3H3,(H,21,22) |
| InChIKey | JPAQKAPNFMDCNG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|