C16H20ClN3O — CID 65269986
3-amino-N-(5-chloroquinolin-8-yl)-2,2,3-trimethylbutanamide (PubChem CID 65269986) has the molecular formula C16H20ClN3O and a molecular weight of 305.81 g/mol. Its IUPAC name is 3-amino-N-(5-chloroquinolin-8-yl)-2,2,3-trimethylbutanamide.
| Compound Name | 3-amino-N-(5-chloroquinolin-8-yl)-2,2,3-trimethylbutanamide |
|---|---|
| PubChem CID | 65269986 |
| Molecular Formula | C16H20ClN3O |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 3-amino-N-(5-chloroquinolin-8-yl)-2,2,3-trimethylbutanamide |
| SMILES | CC(C)(N)C(C)(C)C(=O)Nc1ccc(Cl)c2cccnc12 |
| InChI | InChI=1S/C16H20ClN3O/c1-15(2,16(3,4)18)14(21)20-12-8-7-11(17)10-6-5-9-19-13(10)12/h5-9H,18H2,1-4H3,(H,20,21) |
| InChIKey | YZNANVJANMKYGW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |