C14H14Cl2N2O — CID 63680758
3-chloro-N-(5-chloroquinolin-8-yl)-2,2-dimethylpropanamide (PubChem CID 63680758) has the molecular formula C14H14Cl2N2O and a molecular weight of 297.19 g/mol. Its IUPAC name is 3-chloro-N-(5-chloroquinolin-8-yl)-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-(5-chloroquinolin-8-yl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 63680758 |
| Molecular Formula | C14H14Cl2N2O |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 3-chloro-N-(5-chloroquinolin-8-yl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(CCl)C(=O)Nc1ccc(Cl)c2cccnc12 |
| InChI | InChI=1S/C14H14Cl2N2O/c1-14(2,8-15)13(19)18-11-6-5-10(16)9-4-3-7-17-12(9)11/h3-7H,8H2,1-2H3,(H,18,19) |
| InChIKey | JQPPXKCIKRDLJH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|