C14H17ClN4O — CID 116784971
5-[(5-chloroquinolin-8-yl)amino]-N'-hydroxypentanimidamide (PubChem CID 116784971) has the molecular formula C14H17ClN4O and a molecular weight of 292.77 g/mol. Its IUPAC name is 5-[(5-chloroquinolin-8-yl)amino]-N'-hydroxypentanimidamide.
| Compound Name | 5-[(5-chloroquinolin-8-yl)amino]-N'-hydroxypentanimidamide |
|---|---|
| PubChem CID | 116784971 |
| Molecular Formula | C14H17ClN4O |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 5-[(5-chloroquinolin-8-yl)amino]-N'-hydroxypentanimidamide |
| SMILES | N/C(CCCCNc1ccc(Cl)c2cccnc12)=N/O |
| InChI | InChI=1S/C14H17ClN4O/c15-11-6-7-12(14-10(11)4-3-9-18-14)17-8-2-1-5-13(16)19-20/h3-4,6-7,9,17,20H,1-2,5,8H2,(H2,16,19) |
| InChIKey | RRHMQYQTSXKTHF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|