C11H12ClN3O2S — CID 114384833
2-[(5-chloroquinolin-8-yl)amino]ethanesulfonamide (PubChem CID 114384833) has the molecular formula C11H12ClN3O2S and a molecular weight of 285.76 g/mol. Its IUPAC name is 2-[(5-chloroquinolin-8-yl)amino]ethanesulfonamide.
| Compound Name | 2-[(5-chloroquinolin-8-yl)amino]ethanesulfonamide |
|---|---|
| PubChem CID | 114384833 |
| Molecular Formula | C11H12ClN3O2S |
| Molecular Weight | 285.76 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 2-[(5-chloroquinolin-8-yl)amino]ethanesulfonamide |
| SMILES | NS(=O)(=O)CCNc1ccc(Cl)c2cccnc12 |
| InChI | InChI=1S/C11H12ClN3O2S/c12-9-3-4-10(14-6-7-18(13,16)17)11-8(9)2-1-5-15-11/h1-5,14H,6-7H2,(H2,13,16,17) |
| InChIKey | LRIIVJDIVZZFIZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.76 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |