C12H16N4O — CID 66414096
N-methyl-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)propanamide (PubChem CID 66414096) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is N-methyl-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)propanamide.
| Compound Name | N-methyl-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)propanamide |
|---|---|
| PubChem CID | 66414096 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | N-methyl-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)propanamide |
| SMILES | CNC(=O)CCNCc1c[nH]c2ncccc12 |
| InChI | InChI=1S/C12H16N4O/c1-13-11(17)4-6-14-7-9-8-16-12-10(9)3-2-5-15-12/h2-3,5,8,14H,4,6-7H2,1H3,(H,13,17)(H,15,16) |
| InChIKey | YNVDFQIMBFSACB-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|