C15H15N3O — CID 114331386
4-[(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)methyl]phenol (PubChem CID 114331386) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is 4-[(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)methyl]phenol.
| Compound Name | 4-[(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)methyl]phenol |
|---|---|
| PubChem CID | 114331386 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 4-[(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)methyl]phenol |
| SMILES | Oc1ccc(CNCc2c[nH]c3ncccc23)cc1 |
| InChI | InChI=1S/C15H15N3O/c19-13-5-3-11(4-6-13)8-16-9-12-10-18-15-14(12)2-1-7-17-15/h1-7,10,16,19H,8-9H2,(H,17,18) |
| InChIKey | BULFJMJPRPELFC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |