C14H18N4O4 — CID 17052847
3-imidazol-1-yl-N-(pyridin-3-ylmethyl)propan-1-amine;oxalic acid (PubChem CID 17052847) has the molecular formula C14H18N4O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is 3-imidazol-1-yl-N-(pyridin-3-ylmethyl)propan-1-amine;oxalic acid.
| Compound Name | 3-imidazol-1-yl-N-(pyridin-3-ylmethyl)propan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 17052847 |
| Molecular Formula | C14H18N4O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 3-imidazol-1-yl-N-(pyridin-3-ylmethyl)propan-1-amine;oxalic acid |
| SMILES | O=C(O)C(=O)O.c1cncc(CNCCCn2ccnc2)c1 |
| InChI | InChI=1S/C12H16N4.C2H2O4/c1-3-12(9-13-4-1)10-14-5-2-7-16-8-6-15-11-16;3-1(4)2(5)6/h1,3-4,6,8-9,11,14H,2,5,7,10H2;(H,3,4)(H,5,6) |
| InChIKey | VAXUFNINQOIIJP-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|