About pyridin-3-ylmethyl (Z)-nonadec-8-enoate
pyridin-3-ylmethyl (Z)-nonadec-8-enoate (PubChem CID 91700351) has the molecular formula C25H41NO2
and a molecular weight of 387.61 g/mol. Its IUPAC name is pyridin-3-ylmethyl (Z)-nonadec-8-enoate.
Molecular Properties
| Compound Name | pyridin-3-ylmethyl (Z)-nonadec-8-enoate |
| PubChem CID | 91700351 |
| Molecular Formula | C25H41NO2 |
| Molecular Weight | 387.61 g/mol |
| Exact Mass | 387.31 |
| IUPAC Name | pyridin-3-ylmethyl (Z)-nonadec-8-enoate |
| SMILES | CCCCCCCCCC/C=C\CCCCCCC(=O)OCc1cccnc1 |
| InChI | InChI=1S/C25H41NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-25(27)28-23-24-19-18-21-26-22-24/h11-12,18-19,21-22H,2-10,13-17,20,23H2,1H3/b12-11- |
| InChIKey | BAWLOAAROXGDOT-QXMHVHEDSA-N |
| XLogP | 7.55 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.61 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze pyridin-3-ylmethyl (Z)-nonadec-8-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-3-ylmethyl (Z)-nonadec-8-enoate?
The IUPAC name of pyridin-3-ylmethyl (Z)-nonadec-8-enoate (CID 91700351) is pyridin-3-ylmethyl (Z)-nonadec-8-enoate.
What is the SMILES notation for pyridin-3-ylmethyl (Z)-nonadec-8-enoate?
The canonical SMILES for pyridin-3-ylmethyl (Z)-nonadec-8-enoate is CCCCCCCCCC/C=C\CCCCCCC(=O)OCc1cccnc1.
What is the InChIKey of pyridin-3-ylmethyl (Z)-nonadec-8-enoate?
The InChIKey is BAWLOAAROXGDOT-QXMHVHEDSA-N. The full InChI is InChI=1S/C25H41NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-25(27)28-23-24-19-18-21-26-22-24/h11-12,18-19,21-22H,2-10,13-17,20,23H2,1H3/b12-11-.
What are the key properties of pyridin-3-ylmethyl (Z)-nonadec-8-enoate?
pyridin-3-ylmethyl (Z)-nonadec-8-enoate has a molecular weight of 387.61 g/mol, XLogP of 7.55, 18 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-3-ylmethyl (Z)-nonadec-8-enoate is sourced from PubChem (CID 91700351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).