C24H35NO2 — CID 91700064
pyridin-3-ylmethyl (3Z,9Z,12Z)-octadeca-3,9,12-trienoate (PubChem CID 91700064) has the molecular formula C24H35NO2 and a molecular weight of 369.55 g/mol. Its IUPAC name is pyridin-3-ylmethyl (3Z,9Z,12Z)-octadeca-3,9,12-trienoate.
| Compound Name | pyridin-3-ylmethyl (3Z,9Z,12Z)-octadeca-3,9,12-trienoate |
|---|---|
| PubChem CID | 91700064 |
| Molecular Formula | C24H35NO2 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.27 |
| IUPAC Name | pyridin-3-ylmethyl (3Z,9Z,12Z)-octadeca-3,9,12-trienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCC/C=C\CC(=O)OCc1cccnc1 |
| InChI | InChI=1S/C24H35NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-24(26)27-22-23-18-17-20-25-21-23/h6-7,9-10,15-18,20-21H,2-5,8,11-14,19,22H2,1H3/b7-6-,10-9-,16-15- |
| InChIKey | KKIMNRPHVHEKGP-URZBRJKDSA-N |
| XLogP | 6.71 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|