C28H31NO3Si — CID 123782818
2-[2-(4-aminophenyl)ethenyl]-4-[tert-butyl(diphenyl)silyl]oxybut-2-enoic acid (PubChem CID 123782818) has the molecular formula C28H31NO3Si and a molecular weight of 457.65 g/mol. Its IUPAC name is 2-[2-(4-aminophenyl)ethenyl]-4-[tert-butyl(diphenyl)silyl]oxybut-2-enoic acid.
| Compound Name | 2-[2-(4-aminophenyl)ethenyl]-4-[tert-butyl(diphenyl)silyl]oxybut-2-enoic acid |
|---|---|
| PubChem CID | 123782818 |
| Molecular Formula | C28H31NO3Si |
| Molecular Weight | 457.65 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 2-[2-(4-aminophenyl)ethenyl]-4-[tert-butyl(diphenyl)silyl]oxybut-2-enoic acid |
| SMILES | CC(C)(C)[Si](OCC=C(C=Cc1ccc(N)cc1)C(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H31NO3Si/c1-28(2,3)33(25-10-6-4-7-11-25,26-12-8-5-9-13-26)32-21-20-23(27(30)31)17-14-22-15-18-24(29)19-16-22/h4-20H,21,29H2,1-3H3,(H,30,31) |
| InChIKey | PTNMGPMMYWTMQY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.65 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|