C25H31FO3Si — CID 10741121
ethyl (2E,4E)-6-[tert-butyl(diphenyl)silyl]oxy-2-fluoro-4-methylhexa-2,4-dienoate (PubChem CID 10741121) has the molecular formula C25H31FO3Si and a molecular weight of 426.60 g/mol. Its IUPAC name is ethyl (2E,4E)-6-[tert-butyl(diphenyl)silyl]oxy-2-fluoro-4-methylhexa-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-6-[tert-butyl(diphenyl)silyl]oxy-2-fluoro-4-methylhexa-2,4-dienoate |
|---|---|
| PubChem CID | 10741121 |
| Molecular Formula | C25H31FO3Si |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | ethyl (2E,4E)-6-[tert-butyl(diphenyl)silyl]oxy-2-fluoro-4-methylhexa-2,4-dienoate |
| SMILES | CCOC(=O)/C(F)=C\C(C)=C\CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H31FO3Si/c1-6-28-24(27)23(26)19-20(2)17-18-29-30(25(3,4)5,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-17,19H,6,18H2,1-5H3/b20-17+,23-19+ |
| InChIKey | CNGXWJDZPQCPFC-VJMDKUEOSA-N |
| XLogP | 4.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|