C31H44O5Si — CID 135071395
diethyl 2-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methylhex-4-enyl]propanedioate (PubChem CID 135071395) has the molecular formula C31H44O5Si and a molecular weight of 524.77 g/mol. Its IUPAC name is diethyl 2-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methylhex-4-enyl]propanedioate.
| Compound Name | diethyl 2-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methylhex-4-enyl]propanedioate |
|---|---|
| PubChem CID | 135071395 |
| Molecular Formula | C31H44O5Si |
| Molecular Weight | 524.77 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | diethyl 2-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methylhex-4-enyl]propanedioate |
| SMILES | CCOC(=O)C(CC(CC=C(C)C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C31H44O5Si/c1-8-34-29(32)28(30(33)35-9-2)22-25(21-20-24(3)4)23-36-37(31(5,6)7,26-16-12-10-13-17-26)27-18-14-11-15-19-27/h10-20,25,28H,8-9,21-23H2,1-7H3 |
| InChIKey | HPYLSUQYMRLRLL-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.77 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|