C26H36O2Si — CID 25068244
(2E)-1-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethylocta-2,6-dien-4-ol (PubChem CID 25068244) has the molecular formula C26H36O2Si and a molecular weight of 408.66 g/mol. Its IUPAC name is (2E)-1-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethylocta-2,6-dien-4-ol.
| Compound Name | (2E)-1-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethylocta-2,6-dien-4-ol |
|---|---|
| PubChem CID | 25068244 |
| Molecular Formula | C26H36O2Si |
| Molecular Weight | 408.66 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | (2E)-1-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethylocta-2,6-dien-4-ol |
| SMILES | CC(C)=CCC(O)/C(C)=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H36O2Si/c1-21(2)17-18-25(27)22(3)19-20-28-29(26(4,5)6,23-13-9-7-10-14-23)24-15-11-8-12-16-24/h7-17,19,25,27H,18,20H2,1-6H3/b22-19+ |
| InChIKey | ATDRZOKFIPUWCG-ZBJSNUHESA-N |
| XLogP | 5.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.66 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|