C36H43F3O4Si — CID 102576291
[(2E,4R)-1-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethylocta-2,6-dien-4-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 102576291) has the molecular formula C36H43F3O4Si and a molecular weight of 624.82 g/mol. Its IUPAC name is [(2E,4R)-1-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethylocta-2,6-dien-4-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(2E,4R)-1-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethylocta-2,6-dien-4-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 102576291 |
| Molecular Formula | C36H43F3O4Si |
| Molecular Weight | 624.82 g/mol |
| Exact Mass | 624.29 |
| IUPAC Name | [(2E,4R)-1-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethylocta-2,6-dien-4-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@@](C(=O)O[C@H](CC=C(C)C)/C(C)=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C36H43F3O4Si/c1-27(2)23-24-32(43-33(40)35(41-7,36(37,38)39)29-17-11-8-12-18-29)28(3)25-26-42-44(34(4,5)6,30-19-13-9-14-20-30)31-21-15-10-16-22-31/h8-23,25,32H,24,26H2,1-7H3/b28-25+/t32-,35-/m1/s1 |
| InChIKey | XRIRKIWYRSZJDJ-JMXQRWCPSA-N |
| XLogP | 7.88 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.82 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|