C44H59F3O5Si — CID 23242143
[(3S,4Z,6R,8R,9E)-1-[tert-butyl(diphenyl)silyl]oxy-4,6,8-triethyl-6-hydroxydodeca-4,9-dien-3-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 23242143) has the molecular formula C44H59F3O5Si and a molecular weight of 753.03 g/mol. Its IUPAC name is [(3S,4Z,6R,8R,9E)-1-[tert-butyl(diphenyl)silyl]oxy-4,6,8-triethyl-6-hydroxydodeca-4,9-dien-3-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(3S,4Z,6R,8R,9E)-1-[tert-butyl(diphenyl)silyl]oxy-4,6,8-triethyl-6-hydroxydodeca-4,9-dien-3-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 23242143 |
| Molecular Formula | C44H59F3O5Si |
| Molecular Weight | 753.03 g/mol |
| Exact Mass | 752.41 |
| IUPAC Name | [(3S,4Z,6R,8R,9E)-1-[tert-butyl(diphenyl)silyl]oxy-4,6,8-triethyl-6-hydroxydodeca-4,9-dien-3-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CC/C=C/C(CC)C[C@@](O)(/C=C(/CC)[C@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F)CC |
| InChI | InChI=1S/C44H59F3O5Si/c1-9-13-23-34(10-2)32-42(49,12-4)33-35(11-3)39(52-40(48)43(50-8,44(45,46)47)36-24-17-14-18-25-36)30-31-51-53(41(5,6)7,37-26-19-15-20-27-37)38-28-21-16-22-29-38/h13-29,33-34,39,49H,9-12,30-32H2,1-8H3/b23-13+,35-33-/t34?,39-,42+,43+/m0/s1 |
| InChIKey | ZZOOWGPSLPWZAH-FNYKMTJJSA-N |
| XLogP | 9.83 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.03 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|