C40H41F9O10 — CID 100992349
[(E,2S,6R)-7-hydroxy-3,7-dimethyl-2,6-bis[[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy]oct-3-enyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 100992349) has the molecular formula C40H41F9O10 and a molecular weight of 852.74 g/mol. Its IUPAC name is [(E,2S,6R)-7-hydroxy-3,7-dimethyl-2,6-bis[[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy]oct-3-enyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(E,2S,6R)-7-hydroxy-3,7-dimethyl-2,6-bis[[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy]oct-3-enyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 100992349 |
| Molecular Formula | C40H41F9O10 |
| Molecular Weight | 852.74 g/mol |
| Exact Mass | 852.26 |
| IUPAC Name | [(E,2S,6R)-7-hydroxy-3,7-dimethyl-2,6-bis[[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy]oct-3-enyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@@](C(=O)OC[C@@H](OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F)/C(C)=C/C[C@@H](OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F)C(C)(C)O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C40H41F9O10/c1-25(22-23-30(34(2,3)53)59-33(52)37(56-6,40(47,48)49)28-20-14-9-15-21-28)29(58-32(51)36(55-5,39(44,45)46)27-18-12-8-13-19-27)24-57-31(50)35(54-4,38(41,42)43)26-16-10-7-11-17-26/h7-22,29-30,53H,23-24H2,1-6H3/b25-22+/t29-,30-,35-,36-,37-/m1/s1 |
| InChIKey | FSXFYGPLXFCBGB-LVOILWMTSA-N |
| XLogP | 7.77 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.74 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|