C20H23F3O3 — CID 10666712
(2-methyl-6-methylideneocta-1,7-dien-3-yl) 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 10666712) has the molecular formula C20H23F3O3 and a molecular weight of 368.40 g/mol. Its IUPAC name is (2-methyl-6-methylideneocta-1,7-dien-3-yl) 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | (2-methyl-6-methylideneocta-1,7-dien-3-yl) 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 10666712 |
| Molecular Formula | C20H23F3O3 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | (2-methyl-6-methylideneocta-1,7-dien-3-yl) 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | C=CC(=C)CCC(OC(=O)C(OC)(c1ccccc1)C(F)(F)F)C(=C)C |
| InChI | InChI=1S/C20H23F3O3/c1-6-15(4)12-13-17(14(2)3)26-18(24)19(25-5,20(21,22)23)16-10-8-7-9-11-16/h6-11,17H,1-2,4,12-13H2,3,5H3 |
| InChIKey | RFDKYGNEGMDQAG-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|