C21H29F3O3 — CID 162538357
[(3R,4S)-3-methyldec-1-en-4-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 162538357) has the molecular formula C21H29F3O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is [(3R,4S)-3-methyldec-1-en-4-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(3R,4S)-3-methyldec-1-en-4-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 162538357 |
| Molecular Formula | C21H29F3O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | [(3R,4S)-3-methyldec-1-en-4-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | C=C[C@@H](C)[C@H](CCCCCC)OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C21H29F3O3/c1-5-7-8-12-15-18(16(3)6-2)27-19(25)20(26-4,21(22,23)24)17-13-10-9-11-14-17/h6,9-11,13-14,16,18H,2,5,7-8,12,15H2,1,3-4H3/t16-,18+,20-/m1/s1 |
| InChIKey | VGVGUYFBZQHODV-IMFGXOCKSA-N |
| XLogP | 5.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|