C21H26F3NO3S — CID 10693883
[(1S)-1-(1,3-thiazol-2-yl)octyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 10693883) has the molecular formula C21H26F3NO3S and a molecular weight of 429.50 g/mol. Its IUPAC name is [(1S)-1-(1,3-thiazol-2-yl)octyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(1S)-1-(1,3-thiazol-2-yl)octyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 10693883 |
| Molecular Formula | C21H26F3NO3S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | [(1S)-1-(1,3-thiazol-2-yl)octyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CCCCCCC[C@H](OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F)c1nccs1 |
| InChI | InChI=1S/C21H26F3NO3S/c1-3-4-5-6-10-13-17(18-25-14-15-29-18)28-19(26)20(27-2,21(22,23)24)16-11-8-7-9-12-16/h7-9,11-12,14-15,17H,3-6,10,13H2,1-2H3/t17-,20+/m0/s1 |
| InChIKey | VMWDQQUMZQVYLT-FXAWDEMLSA-N |
| XLogP | 6.19 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|