C20H24F3NO3S — CID 10597935
[(1R)-1-(1,3-thiazol-2-yl)heptyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 10597935) has the molecular formula C20H24F3NO3S and a molecular weight of 415.48 g/mol. Its IUPAC name is [(1R)-1-(1,3-thiazol-2-yl)heptyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(1R)-1-(1,3-thiazol-2-yl)heptyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 10597935 |
| Molecular Formula | C20H24F3NO3S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | [(1R)-1-(1,3-thiazol-2-yl)heptyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CCCCCC[C@@H](OC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F)c1nccs1 |
| InChI | InChI=1S/C20H24F3NO3S/c1-3-4-5-9-12-16(17-24-13-14-28-17)27-18(25)19(26-2,20(21,22)23)15-10-7-6-8-11-15/h6-8,10-11,13-14,16H,3-5,9,12H2,1-2H3/t16-,19+/m1/s1 |
| InChIKey | HARKTYCFVBDISY-APWZRJJASA-N |
| XLogP | 5.80 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|