C23H33F3O5 — CID 14496577
methyl 11-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxydodecanoate (PubChem CID 14496577) has the molecular formula C23H33F3O5 and a molecular weight of 446.51 g/mol. Its IUPAC name is methyl 11-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxydodecanoate.
| Compound Name | methyl 11-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxydodecanoate |
|---|---|
| PubChem CID | 14496577 |
| Molecular Formula | C23H33F3O5 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | methyl 11-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxydodecanoate |
| SMILES | COC(=O)CCCCCCCCCC(C)OC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C23H33F3O5/c1-18(14-10-7-5-4-6-8-13-17-20(27)29-2)31-21(28)22(30-3,23(24,25)26)19-15-11-9-12-16-19/h9,11-12,15-16,18H,4-8,10,13-14,17H2,1-3H3/t18?,22-/m0/s1 |
| InChIKey | LSUJDHKNXACBGA-YSYXNDDBSA-N |
| XLogP | 5.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|