C25H29F3O6 — CID 101461211
[(E,2S)-7-[5-(3-methoxy-3-oxopropyl)furan-2-yl]hept-6-en-2-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 101461211) has the molecular formula C25H29F3O6 and a molecular weight of 482.50 g/mol. Its IUPAC name is [(E,2S)-7-[5-(3-methoxy-3-oxopropyl)furan-2-yl]hept-6-en-2-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(E,2S)-7-[5-(3-methoxy-3-oxopropyl)furan-2-yl]hept-6-en-2-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 101461211 |
| Molecular Formula | C25H29F3O6 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | [(E,2S)-7-[5-(3-methoxy-3-oxopropyl)furan-2-yl]hept-6-en-2-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | COC(=O)CCc1ccc(/C=C/CCC[C@H](C)OC(=O)[C@](OC)(c2ccccc2)C(F)(F)F)o1 |
| InChI | InChI=1S/C25H29F3O6/c1-18(10-6-4-9-13-20-14-15-21(34-20)16-17-22(29)31-2)33-23(30)24(32-3,25(26,27)28)19-11-7-5-8-12-19/h5,7-9,11-15,18H,4,6,10,16-17H2,1-3H3/b13-9+/t18-,24+/m0/s1 |
| InChIKey | JVKIAJUPLKFZPL-IPPGUWHGSA-N |
| XLogP | 5.60 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|