C33H43F3O6 — CID 23242129
methyl (3S,12E)-6-oxo-3-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxydocosa-12,21-dien-10-ynoate (PubChem CID 23242129) has the molecular formula C33H43F3O6 and a molecular weight of 592.70 g/mol. Its IUPAC name is methyl (3S,12E)-6-oxo-3-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxydocosa-12,21-dien-10-ynoate.
| Compound Name | methyl (3S,12E)-6-oxo-3-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxydocosa-12,21-dien-10-ynoate |
|---|---|
| PubChem CID | 23242129 |
| Molecular Formula | C33H43F3O6 |
| Molecular Weight | 592.70 g/mol |
| Exact Mass | 592.30 |
| IUPAC Name | methyl (3S,12E)-6-oxo-3-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxydocosa-12,21-dien-10-ynoate |
| SMILES | C=CCCCCCCC/C=C/C#CCCCC(=O)CC[C@@H](CC(=O)OC)OC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C33H43F3O6/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-20-23-28(37)24-25-29(26-30(38)40-2)42-31(39)32(41-3,33(34,35)36)27-21-18-17-19-22-27/h4,12-13,17-19,21-22,29H,1,5-11,16,20,23-26H2,2-3H3/b13-12+/t29-,32-/m0/s1 |
| InChIKey | GBLKUQCPQFALHB-DZHNBRSZSA-N |
| XLogP | 7.56 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.70 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|