C25H33F3O3 — CID 162539873
[(4R)-pentadec-1-en-14-yn-4-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 162539873) has the molecular formula C25H33F3O3 and a molecular weight of 438.53 g/mol. Its IUPAC name is [(4R)-pentadec-1-en-14-yn-4-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(4R)-pentadec-1-en-14-yn-4-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 162539873 |
| Molecular Formula | C25H33F3O3 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | [(4R)-pentadec-1-en-14-yn-4-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | C#CCCCCCCCCC[C@H](CC=C)OC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C25H33F3O3/c1-4-6-7-8-9-10-11-12-16-20-22(17-5-2)31-23(29)24(30-3,25(26,27)28)21-18-14-13-15-19-21/h1,5,13-15,18-19,22H,2,6-12,16-17,20H2,3H3/t22-,24-/m0/s1 |
| InChIKey | QTQQEMJQIFSWJM-UPVQGACJSA-N |
| XLogP | 6.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|