C20H27F3O5 — CID 11682853
[(3R,4S)-7,7-dimethoxy-3-methylhept-1-en-4-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 11682853) has the molecular formula C20H27F3O5 and a molecular weight of 404.43 g/mol. Its IUPAC name is [(3R,4S)-7,7-dimethoxy-3-methylhept-1-en-4-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(3R,4S)-7,7-dimethoxy-3-methylhept-1-en-4-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 11682853 |
| Molecular Formula | C20H27F3O5 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | [(3R,4S)-7,7-dimethoxy-3-methylhept-1-en-4-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | C=C[C@@H](C)[C@H](CCC(OC)OC)OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C20H27F3O5/c1-6-14(2)16(12-13-17(25-3)26-4)28-18(24)19(27-5,20(21,22)23)15-10-8-7-9-11-15/h6-11,14,16-17H,1,12-13H2,2-5H3/t14-,16+,19-/m1/s1 |
| InChIKey | OTNMUWRBPMMCCW-SIXWZSSISA-N |
| XLogP | 4.22 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|