C38H42F6O7 — CID 16656286
[(3S,9R,10R)-10-methoxy-3-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyheptadec-1-en-4,6-diyn-9-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 16656286) has the molecular formula C38H42F6O7 and a molecular weight of 724.74 g/mol. Its IUPAC name is [(3S,9R,10R)-10-methoxy-3-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyheptadec-1-en-4,6-diyn-9-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(3S,9R,10R)-10-methoxy-3-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyheptadec-1-en-4,6-diyn-9-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 16656286 |
| Molecular Formula | C38H42F6O7 |
| Molecular Weight | 724.74 g/mol |
| Exact Mass | 724.28 |
| IUPAC Name | [(3S,9R,10R)-10-methoxy-3-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyheptadec-1-en-4,6-diyn-9-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | C=C[C@@H](C#CC#CC[C@@H](OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F)[C@@H](CCCCCCC)OC)OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C38H42F6O7/c1-6-8-9-10-19-26-31(47-3)32(51-34(46)36(49-5,38(42,43)44)29-23-16-12-17-24-29)27-20-13-18-25-30(7-2)50-33(45)35(48-4,37(39,40)41)28-21-14-11-15-22-28/h7,11-12,14-17,21-24,30-32H,2,6,8-10,19,26-27H2,1,3-5H3/t30-,31+,32+,35+,36+/m0/s1 |
| InChIKey | QQAGKZLWMVHVKO-FIUWERDLSA-N |
| XLogP | 7.98 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.74 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|