C31H33F9O6 — CID 10818223
[(E)-2-(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)oxy-3-(trifluoromethyl)dec-4-enyl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 10818223) has the molecular formula C31H33F9O6 and a molecular weight of 672.58 g/mol. Its IUPAC name is [(E)-2-(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)oxy-3-(trifluoromethyl)dec-4-enyl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(E)-2-(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)oxy-3-(trifluoromethyl)dec-4-enyl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 10818223 |
| Molecular Formula | C31H33F9O6 |
| Molecular Weight | 672.58 g/mol |
| Exact Mass | 672.21 |
| IUPAC Name | [(E)-2-(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)oxy-3-(trifluoromethyl)dec-4-enyl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CCCCC/C=C/C(C(COC(=O)C(OC)(c1ccccc1)C(F)(F)F)OC(=O)C(OC)(c1ccccc1)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C31H33F9O6/c1-4-5-6-7-14-19-23(29(32,33)34)24(46-26(42)28(44-3,31(38,39)40)22-17-12-9-13-18-22)20-45-25(41)27(43-2,30(35,36)37)21-15-10-8-11-16-21/h8-19,23-24H,4-7,20H2,1-3H3/b19-14+ |
| InChIKey | YRDDNFRSTXJWIN-XMHGGMMESA-N |
| XLogP | 7.96 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.58 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|