C33H32F6O6 — CID 46915248
[(E,5S)-7-phenyl-5-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyhept-3-enyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 46915248) has the molecular formula C33H32F6O6 and a molecular weight of 638.60 g/mol. Its IUPAC name is [(E,5S)-7-phenyl-5-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyhept-3-enyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(E,5S)-7-phenyl-5-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyhept-3-enyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 46915248 |
| Molecular Formula | C33H32F6O6 |
| Molecular Weight | 638.60 g/mol |
| Exact Mass | 638.21 |
| IUPAC Name | [(E,5S)-7-phenyl-5-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyhept-3-enyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@@](C(=O)OCC/C=C/[C@H](CCc1ccccc1)OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C33H32F6O6/c1-42-30(32(34,35)36,25-16-8-4-9-17-25)28(40)44-23-13-12-20-27(22-21-24-14-6-3-7-15-24)45-29(41)31(43-2,33(37,38)39)26-18-10-5-11-19-26/h3-12,14-20,27H,13,21-23H2,1-2H3/b20-12+/t27-,30-,31-/m1/s1 |
| InChIKey | VJYKVXJIILZQET-YJMNKUHDSA-N |
| XLogP | 7.23 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.60 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|