C18H21F3O5 — CID 118201375
ethyl (E)-3-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyhex-4-enoate (PubChem CID 118201375) has the molecular formula C18H21F3O5 and a molecular weight of 374.36 g/mol. Its IUPAC name is ethyl (E)-3-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyhex-4-enoate.
| Compound Name | ethyl (E)-3-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyhex-4-enoate |
|---|---|
| PubChem CID | 118201375 |
| Molecular Formula | C18H21F3O5 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | ethyl (E)-3-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyhex-4-enoate |
| SMILES | C/C=C/C(CC(=O)OCC)OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H21F3O5/c1-4-9-14(12-15(22)25-5-2)26-16(23)17(24-3,18(19,20)21)13-10-7-6-8-11-13/h4,6-11,14H,5,12H2,1-3H3/b9-4+/t14?,17-/m1/s1 |
| InChIKey | UHHIHEISJNMPCP-CXDTWDMOSA-N |
| XLogP | 3.53 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|