C24H24F6O7 — CID 11699471
ethyl (2S,3R)-4,4,4-trifluoro-3-hydroxy-3-(phenylmethoxymethyl)-2-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxybutanoate (PubChem CID 11699471) has the molecular formula C24H24F6O7 and a molecular weight of 538.44 g/mol. Its IUPAC name is ethyl (2S,3R)-4,4,4-trifluoro-3-hydroxy-3-(phenylmethoxymethyl)-2-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxybutanoate.
| Compound Name | ethyl (2S,3R)-4,4,4-trifluoro-3-hydroxy-3-(phenylmethoxymethyl)-2-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxybutanoate |
|---|---|
| PubChem CID | 11699471 |
| Molecular Formula | C24H24F6O7 |
| Molecular Weight | 538.44 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | ethyl (2S,3R)-4,4,4-trifluoro-3-hydroxy-3-(phenylmethoxymethyl)-2-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxybutanoate |
| SMILES | CCOC(=O)[C@@H](OC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F)[C@](O)(COCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C24H24F6O7/c1-3-36-19(31)18(21(33,23(25,26)27)15-35-14-16-10-6-4-7-11-16)37-20(32)22(34-2,24(28,29)30)17-12-8-5-9-13-17/h4-13,18,33H,3,14-15H2,1-2H3/t18-,21-,22+/m1/s1 |
| InChIKey | LXQRPBBMHKDFAB-QIJUGHKUSA-N |
| XLogP | 4.08 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |