C24H31F3O7 — CID 10791171
diethyl 2-[(E,5S)-4-methyl-5-(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)oxyhex-3-enyl]propanedioate (PubChem CID 10791171) has the molecular formula C24H31F3O7 and a molecular weight of 488.50 g/mol. Its IUPAC name is diethyl 2-[(E,5S)-4-methyl-5-(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)oxyhex-3-enyl]propanedioate.
| Compound Name | diethyl 2-[(E,5S)-4-methyl-5-(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)oxyhex-3-enyl]propanedioate |
|---|---|
| PubChem CID | 10791171 |
| Molecular Formula | C24H31F3O7 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | diethyl 2-[(E,5S)-4-methyl-5-(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)oxyhex-3-enyl]propanedioate |
| SMILES | CCOC(=O)C(CC/C=C(\C)[C@H](C)OC(=O)C(OC)(c1ccccc1)C(F)(F)F)C(=O)OCC |
| InChI | InChI=1S/C24H31F3O7/c1-6-32-20(28)19(21(29)33-7-2)15-11-12-16(3)17(4)34-22(30)23(31-5,24(25,26)27)18-13-9-8-10-14-18/h8-10,12-14,17,19H,6-7,11,15H2,1-5H3/b16-12+/t17-,23?/m0/s1 |
| InChIKey | PDOCYROBLRXFSX-DIYGSOQSSA-N |
| XLogP | 4.49 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|