C25H26ClF3O5 — CID 10649020
[(E,4R)-8-chloro-6-oxo-1-phenylmethoxyoct-7-en-4-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 10649020) has the molecular formula C25H26ClF3O5 and a molecular weight of 498.93 g/mol. Its IUPAC name is [(E,4R)-8-chloro-6-oxo-1-phenylmethoxyoct-7-en-4-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(E,4R)-8-chloro-6-oxo-1-phenylmethoxyoct-7-en-4-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 10649020 |
| Molecular Formula | C25H26ClF3O5 |
| Molecular Weight | 498.93 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | [(E,4R)-8-chloro-6-oxo-1-phenylmethoxyoct-7-en-4-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@](C(=O)O[C@H](CCCOCc1ccccc1)CC(=O)/C=C/Cl)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C25H26ClF3O5/c1-32-24(25(27,28)29,20-11-6-3-7-12-20)23(31)34-22(17-21(30)14-15-26)13-8-16-33-18-19-9-4-2-5-10-19/h2-7,9-12,14-15,22H,8,13,16-18H2,1H3/b15-14+/t22-,24+/m1/s1 |
| InChIKey | PGDFWBSSRCEAGN-LDSODUJTSA-N |
| XLogP | 5.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.93 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|