C39H42F6O6 — CID 46913941
[(E,3R,7R)-7-cyclohexyl-1-phenyl-7-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyhept-5-en-3-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 46913941) has the molecular formula C39H42F6O6 and a molecular weight of 720.75 g/mol. Its IUPAC name is [(E,3R,7R)-7-cyclohexyl-1-phenyl-7-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyhept-5-en-3-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(E,3R,7R)-7-cyclohexyl-1-phenyl-7-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyhept-5-en-3-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 46913941 |
| Molecular Formula | C39H42F6O6 |
| Molecular Weight | 720.75 g/mol |
| Exact Mass | 720.29 |
| IUPAC Name | [(E,3R,7R)-7-cyclohexyl-1-phenyl-7-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyhept-5-en-3-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@](C(=O)O[C@@H](C/C=C/[C@H](OC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F)C1CCCCC1)CCc1ccccc1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C39H42F6O6/c1-48-36(38(40,41)42,30-20-11-5-12-21-30)34(46)50-32(27-26-28-16-7-3-8-17-28)24-15-25-33(29-18-9-4-10-19-29)51-35(47)37(49-2,39(43,44)45)31-22-13-6-14-23-31/h3,5-8,11-17,20-23,25,29,32-33H,4,9-10,18-19,24,26-27H2,1-2H3/b25-15+/t32-,33-,36-,37-/m0/s1 |
| InChIKey | IZLRVKCROIHXOO-HLJFVMTHSA-N |
| XLogP | 9.18 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.75 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|