C20H25F3O4 — CID 10715166
[(E,1S)-1-[(2S,3S)-3-methyloxiran-2-yl]hept-2-enyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 10715166) has the molecular formula C20H25F3O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is [(E,1S)-1-[(2S,3S)-3-methyloxiran-2-yl]hept-2-enyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(E,1S)-1-[(2S,3S)-3-methyloxiran-2-yl]hept-2-enyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 10715166 |
| Molecular Formula | C20H25F3O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | [(E,1S)-1-[(2S,3S)-3-methyloxiran-2-yl]hept-2-enyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CCCC/C=C/[C@H](OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F)[C@H]1O[C@H]1C |
| InChI | InChI=1S/C20H25F3O4/c1-4-5-6-10-13-16(17-14(2)26-17)27-18(24)19(25-3,20(21,22)23)15-11-8-7-9-12-15/h7-14,16-17H,4-6H2,1-3H3/b13-10+/t14-,16-,17-,19+/m0/s1 |
| InChIKey | XPWHCGPNQDOBFE-VIZIXFSOSA-N |
| XLogP | 4.54 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|