C33H44F3NO4 — CID 42637867
[(1S,2S)-2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]cyclopropyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 42637867) has the molecular formula C33H44F3NO4 and a molecular weight of 575.71 g/mol. Its IUPAC name is [(1S,2S)-2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]cyclopropyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(1S,2S)-2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]cyclopropyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 42637867 |
| Molecular Formula | C33H44F3NO4 |
| Molecular Weight | 575.71 g/mol |
| Exact Mass | 575.32 |
| IUPAC Name | [(1S,2S)-2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]cyclopropyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)N[C@H]1C[C@@H]1OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C33H44F3NO4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-25-30(38)37-28-26-29(28)41-31(39)32(40-2,33(34,35)36)27-23-20-19-21-24-27/h7-8,10-11,13-14,16-17,19-21,23-24,28-29H,3-6,9,12,15,18,22,25-26H2,1-2H3,(H,37,38)/b8-7-,11-10-,14-13-,17-16-/t28-,29-,32+/m0/s1 |
| InChIKey | OYNFVYXSWNIQNK-UQTFCFFXSA-N |
| XLogP | 8.04 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.71 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|