C23H37NO — CID 124933455
(5Z,8E,11E,14E)-N-cyclopropylicosa-5,8,11,14-tetraenamide (PubChem CID 124933455) has the molecular formula C23H37NO and a molecular weight of 343.56 g/mol. Its IUPAC name is (5Z,8E,11E,14E)-N-cyclopropylicosa-5,8,11,14-tetraenamide.
| Compound Name | (5Z,8E,11E,14E)-N-cyclopropylicosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 124933455 |
| Molecular Formula | C23H37NO |
| Molecular Weight | 343.56 g/mol |
| Exact Mass | 343.29 |
| IUPAC Name | (5Z,8E,11E,14E)-N-cyclopropylicosa-5,8,11,14-tetraenamide |
| SMILES | CCCCC/C=C/C/C=C/C/C=C/C/C=C\CCCC(=O)NC1CC1 |
| InChI | InChI=1S/C23H37NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(25)24-22-20-21-22/h6-7,9-10,12-13,15-16,22H,2-5,8,11,14,17-21H2,1H3,(H,24,25)/b7-6+,10-9+,13-12+,16-15- |
| InChIKey | GLGAUBPACOBAMV-LIJGZOPESA-N |
| XLogP | 6.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.56 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|