C25H41NO — CID 2013
N-(2-cyclopropylethyl)icosa-5,8,11,14-tetraenamide (PubChem CID 2013) has the molecular formula C25H41NO and a molecular weight of 371.61 g/mol. Its IUPAC name is N-(2-cyclopropylethyl)icosa-5,8,11,14-tetraenamide.
| Compound Name | N-(2-cyclopropylethyl)icosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 2013 |
| Molecular Formula | C25H41NO |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 371.32 |
| IUPAC Name | N-(2-cyclopropylethyl)icosa-5,8,11,14-tetraenamide |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)NCCC1CC1 |
| InChI | InChI=1S/C25H41NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25(27)26-23-22-24-20-21-24/h6-7,9-10,12-13,15-16,24H,2-5,8,11,14,17-23H2,1H3,(H,26,27) |
| InChIKey | KSLBVHPSPDQUBH-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|