C23H42N2O2 — CID 123554011
N-cyclopropyl-N'-pentylpentadec-5-enediamide (PubChem CID 123554011) has the molecular formula C23H42N2O2 and a molecular weight of 378.60 g/mol. Its IUPAC name is N-cyclopropyl-N'-pentylpentadec-5-enediamide.
| Compound Name | N-cyclopropyl-N'-pentylpentadec-5-enediamide |
|---|---|
| PubChem CID | 123554011 |
| Molecular Formula | C23H42N2O2 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.32 |
| IUPAC Name | N-cyclopropyl-N'-pentylpentadec-5-enediamide |
| SMILES | CCCCCNC(=O)CCCCCCCCC=CCCCC(=O)NC1CC1 |
| InChI | InChI=1S/C23H42N2O2/c1-2-3-15-20-24-22(26)16-13-11-9-7-5-4-6-8-10-12-14-17-23(27)25-21-18-19-21/h8,10,21H,2-7,9,11-20H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | MYZHVLGXCIBSRR-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|