C23H37NO2 — CID 88934028
(5Z,8Z,11Z)-N-cyclopropyl-13-(3-pentyloxiran-2-yl)trideca-5,8,11-trienamide (PubChem CID 88934028) has the molecular formula C23H37NO2 and a molecular weight of 359.55 g/mol. Its IUPAC name is (5Z,8Z,11Z)-N-cyclopropyl-13-(3-pentyloxiran-2-yl)trideca-5,8,11-trienamide.
| Compound Name | (5Z,8Z,11Z)-N-cyclopropyl-13-(3-pentyloxiran-2-yl)trideca-5,8,11-trienamide |
|---|---|
| PubChem CID | 88934028 |
| Molecular Formula | C23H37NO2 |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.28 |
| IUPAC Name | (5Z,8Z,11Z)-N-cyclopropyl-13-(3-pentyloxiran-2-yl)trideca-5,8,11-trienamide |
| SMILES | CCCCCC1OC1C/C=C\C/C=C\C/C=C\CCCC(=O)NC1CC1 |
| InChI | InChI=1S/C23H37NO2/c1-2-3-12-15-21-22(26-21)16-13-10-8-6-4-5-7-9-11-14-17-23(25)24-20-18-19-20/h4,6-7,9-10,13,20-22H,2-3,5,8,11-12,14-19H2,1H3,(H,24,25)/b6-4-,9-7-,13-10- |
| InChIKey | ZOCUOCHMYZYGGZ-ILYOTBPNSA-N |
| XLogP | 5.62 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|