C31H46F3NO4 — CID 42637940
[(1S,2R)-2-[[(Z)-octadec-9-enoyl]amino]cyclopropyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 42637940) has the molecular formula C31H46F3NO4 and a molecular weight of 553.71 g/mol. Its IUPAC name is [(1S,2R)-2-[[(Z)-octadec-9-enoyl]amino]cyclopropyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(1S,2R)-2-[[(Z)-octadec-9-enoyl]amino]cyclopropyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 42637940 |
| Molecular Formula | C31H46F3NO4 |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.34 |
| IUPAC Name | [(1S,2R)-2-[[(Z)-octadec-9-enoyl]amino]cyclopropyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@@H]1C[C@@H]1OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C31H46F3NO4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-23-28(36)35-26-24-27(26)39-29(37)30(38-2,31(32,33)34)25-21-18-17-19-22-25/h10-11,17-19,21-22,26-27H,3-9,12-16,20,23-24H2,1-2H3,(H,35,36)/b11-10-/t26-,27+,30-/m1/s1 |
| InChIKey | ZRRSYJJJTQZSAR-ZYRYVOSKSA-N |
| XLogP | 7.93 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|