C28H29F6NO6 — CID 102304353
[(1S,3S,5R,6R)-8-methyl-6-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-8-azabicyclo[3.2.1]octan-3-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 102304353) has the molecular formula C28H29F6NO6 and a molecular weight of 589.53 g/mol. Its IUPAC name is [(1S,3S,5R,6R)-8-methyl-6-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-8-azabicyclo[3.2.1]octan-3-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(1S,3S,5R,6R)-8-methyl-6-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-8-azabicyclo[3.2.1]octan-3-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 102304353 |
| Molecular Formula | C28H29F6NO6 |
| Molecular Weight | 589.53 g/mol |
| Exact Mass | 589.19 |
| IUPAC Name | [(1S,3S,5R,6R)-8-methyl-6-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-8-azabicyclo[3.2.1]octan-3-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@](C(=O)O[C@H]1C[C@H]2C[C@@H](OC(=O)[C@@](OC)(c3ccccc3)C(F)(F)F)[C@@H](C1)N2C)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C28H29F6NO6/c1-35-19-14-20(40-23(36)25(38-2,27(29,30)31)17-10-6-4-7-11-17)16-21(35)22(15-19)41-24(37)26(39-3,28(32,33)34)18-12-8-5-9-13-18/h4-13,19-22H,14-16H2,1-3H3/t19-,20-,21+,22+,25-,26-/m0/s1 |
| InChIKey | KEAHIORSRNFJNV-REQDVVOUSA-N |
| XLogP | 4.88 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |