C29H37F3O6 — CID 56951542
methyl (Z)-7-[(1R,2S,3S,5S)-3-[(1S,2R)-2-[(1R)-1-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxypropyl]cyclopropyl]-6-oxabicyclo[3.1.0]hexan-2-yl]hept-6-enoate (PubChem CID 56951542) has the molecular formula C29H37F3O6 and a molecular weight of 538.60 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2S,3S,5S)-3-[(1S,2R)-2-[(1R)-1-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxypropyl]cyclopropyl]-6-oxabicyclo[3.1.0]hexan-2-yl]hept-6-enoate.
| Compound Name | methyl (Z)-7-[(1R,2S,3S,5S)-3-[(1S,2R)-2-[(1R)-1-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxypropyl]cyclopropyl]-6-oxabicyclo[3.1.0]hexan-2-yl]hept-6-enoate |
|---|---|
| PubChem CID | 56951542 |
| Molecular Formula | C29H37F3O6 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | methyl (Z)-7-[(1R,2S,3S,5S)-3-[(1S,2R)-2-[(1R)-1-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxypropyl]cyclopropyl]-6-oxabicyclo[3.1.0]hexan-2-yl]hept-6-enoate |
| SMILES | CC[C@@H](OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F)[C@@H]1C[C@H]1[C@@H]1C[C@@H]2O[C@@H]2[C@H]1/C=C\CCCCC(=O)OC |
| InChI | InChI=1S/C29H37F3O6/c1-4-23(38-27(34)28(36-3,29(30,31)32)18-12-8-7-9-13-18)22-16-20(22)21-17-24-26(37-24)19(21)14-10-5-6-11-15-25(33)35-2/h7-10,12-14,19-24,26H,4-6,11,15-17H2,1-3H3/b14-10-/t19-,20-,21+,22+,23+,24-,26+,28+/m0/s1 |
| InChIKey | FGSRIZMQXDRPCL-YPRYNEQBSA-N |
| XLogP | 5.74 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|