C21H31ClO3 — CID 22832800
methyl (5Z,8Z,11Z)-12-[(1R,2S,3R,5S)-3-[(1S)-1-chloropropyl]-6-oxabicyclo[3.1.0]hexan-2-yl]dodeca-5,8,11-trienoate (PubChem CID 22832800) has the molecular formula C21H31ClO3 and a molecular weight of 366.93 g/mol. Its IUPAC name is methyl (5Z,8Z,11Z)-12-[(1R,2S,3R,5S)-3-[(1S)-1-chloropropyl]-6-oxabicyclo[3.1.0]hexan-2-yl]dodeca-5,8,11-trienoate.
| Compound Name | methyl (5Z,8Z,11Z)-12-[(1R,2S,3R,5S)-3-[(1S)-1-chloropropyl]-6-oxabicyclo[3.1.0]hexan-2-yl]dodeca-5,8,11-trienoate |
|---|---|
| PubChem CID | 22832800 |
| Molecular Formula | C21H31ClO3 |
| Molecular Weight | 366.93 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | methyl (5Z,8Z,11Z)-12-[(1R,2S,3R,5S)-3-[(1S)-1-chloropropyl]-6-oxabicyclo[3.1.0]hexan-2-yl]dodeca-5,8,11-trienoate |
| SMILES | CC[C@H](Cl)[C@@H]1C[C@@H]2O[C@@H]2[C@H]1/C=C\C/C=C\C/C=C\CCCC(=O)OC |
| InChI | InChI=1S/C21H31ClO3/c1-3-18(22)17-15-19-21(25-19)16(17)13-11-9-7-5-4-6-8-10-12-14-20(23)24-2/h5-8,11,13,16-19,21H,3-4,9-10,12,14-15H2,1-2H3/b7-5-,8-6-,13-11-/t16-,17+,18-,19-,21+/m0/s1 |
| InChIKey | RQOGDHBYTJYMHH-CYPATCKXSA-N |
| XLogP | 5.20 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.93 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|